C14H21NO2 — CID 91335559
N,N-dipropyl-3,4-dihydro-1,2-benzodioxin-4-amine (PubChem CID 91335559) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N,N-dipropyl-3,4-dihydro-1,2-benzodioxin-4-amine.
| Compound Name | N,N-dipropyl-3,4-dihydro-1,2-benzodioxin-4-amine |
|---|---|
| PubChem CID | 91335559 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N,N-dipropyl-3,4-dihydro-1,2-benzodioxin-4-amine |
| SMILES | CCCN(CCC)C1COOc2ccccc21 |
| InChI | InChI=1S/C14H21NO2/c1-3-9-15(10-4-2)13-11-16-17-14-8-6-5-7-12(13)14/h5-8,13H,3-4,9-11H2,1-2H3 |
| InChIKey | YUUDHQYIAOYWMU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|