C18H14Cl3N5O — CID 91335840
4-N-[4-(1-nitrosoethyl)phenyl]-6-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 91335840) has the molecular formula C18H14Cl3N5O and a molecular weight of 422.70 g/mol. Its IUPAC name is 4-N-[4-(1-nitrosoethyl)phenyl]-6-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-(1-nitrosoethyl)phenyl]-6-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91335840 |
| Molecular Formula | C18H14Cl3N5O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 4-N-[4-(1-nitrosoethyl)phenyl]-6-(2,3,5-trichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | CC(N=O)c1ccc(Nc2cc(-c3cc(Cl)cc(Cl)c3Cl)nc(N)n2)cc1 |
| InChI | InChI=1S/C18H14Cl3N5O/c1-9(26-27)10-2-4-12(5-3-10)23-16-8-15(24-18(22)25-16)13-6-11(19)7-14(20)17(13)21/h2-9H,1H3,(H3,22,23,24,25) |
| InChIKey | ZDYBBWKLCKQXJW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|