About (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate
(1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate (PubChem CID 91335852) has the molecular formula C25H21NO4
and a molecular weight of 399.45 g/mol. Its IUPAC name is (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate.
Molecular Properties
| Compound Name | (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate |
| PubChem CID | 91335852 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2(C(N)=O)CC2)cc1-c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21NO4/c1-16-7-8-20(23(28)30-25(13-14-25)24(26)29)15-21(16)17-9-11-19(12-10-17)22(27)18-5-3-2-4-6-18/h2-12,15H,13-14H2,1H3,(H2,26,29) |
| InChIKey | GHVCNOAJMIGHGD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate?
The IUPAC name of (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate (CID 91335852) is (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate.
What is the SMILES notation for (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate?
The canonical SMILES for (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate is Cc1ccc(C(=O)OC2(C(N)=O)CC2)cc1-c1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate?
The InChIKey is GHVCNOAJMIGHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO4/c1-16-7-8-20(23(28)30-25(13-14-25)24(26)29)15-21(16)17-9-11-19(12-10-17)22(27)18-5-3-2-4-6-18/h2-12,15H,13-14H2,1H3,(H2,26,29).
What are the key properties of (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate?
(1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate has a molecular weight of 399.45 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclopropyl) 3-(4-benzoylphenyl)-4-methylbenzoate is sourced from PubChem (CID 91335852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).