About (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide
(4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (PubChem CID 91336050) has the molecular formula C17H19FN2O
and a molecular weight of 286.35 g/mol. Its IUPAC name is (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
Molecular Properties
| Compound Name | (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| PubChem CID | 91336050 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| SMILES | COC1CCC2(CC1)Cc1c(F)ccc(C)c1/C2=N\C#N |
| InChI | InChI=1S/C17H19FN2O/c1-11-3-4-14(18)13-9-17(16(15(11)13)20-10-19)7-5-12(21-2)6-8-17/h3-4,12H,5-9H2,1-2H3/b20-16+ |
| InChIKey | QJIFOPWCEKWJDS-CAPFRKAQSA-N |
| XLogP | 3.54 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The IUPAC name of (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (CID 91336050) is (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
What is the SMILES notation for (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The canonical SMILES for (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide is COC1CCC2(CC1)Cc1c(F)ccc(C)c1/C2=N\C#N.
What is the InChIKey of (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
The InChIKey is QJIFOPWCEKWJDS-CAPFRKAQSA-N. The full InChI is InChI=1S/C17H19FN2O/c1-11-3-4-14(18)13-9-17(16(15(11)13)20-10-19)7-5-12(21-2)6-8-17/h3-4,12H,5-9H2,1-2H3/b20-16+.
What are the key properties of (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide?
(4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide has a molecular weight of 286.35 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-4'-methoxy-7-methylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide is sourced from PubChem (CID 91336050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).