C17H13F3N2O4 — CID 91336110
N-[(1,3-dihydroxy-2-phenyl-7H-4,7-epoxyisoindol-4-yl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 91336110) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is N-[(1,3-dihydroxy-2-phenyl-7H-4,7-epoxyisoindol-4-yl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1,3-dihydroxy-2-phenyl-7H-4,7-epoxyisoindol-4-yl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91336110 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[(1,3-dihydroxy-2-phenyl-7H-4,7-epoxyisoindol-4-yl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCC12C=CC(O1)c1c2c(O)n(-c2ccccc2)c1O)C(F)(F)F |
| InChI | InChI=1S/C17H13F3N2O4/c18-17(19,20)15(25)21-8-16-7-6-10(26-16)11-12(16)14(24)22(13(11)23)9-4-2-1-3-5-9/h1-7,10,23-24H,8H2,(H,21,25) |
| InChIKey | SEXBBUQZCZUPAG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|