About 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone
1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone (PubChem CID 91336310) has the molecular formula C13H24N2O4S
and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone.
Molecular Properties
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone |
| PubChem CID | 91336310 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone |
| SMILES | CC(=O)N1CCCCC1.CC(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H13NO.C6H11NO3S/c1-7(9)8-5-3-2-4-6-8;1-6(8)7-2-4-11(9,10)5-3-7/h2-6H2,1H3;2-5H2,1H3 |
| InChIKey | ZSKPJHGZSCYWHS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone?
The IUPAC name of 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone (CID 91336310) is 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone.
What is the SMILES notation for 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone?
The canonical SMILES for 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone is CC(=O)N1CCCCC1.CC(=O)N1CCS(=O)(=O)CC1.
What is the InChIKey of 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone?
The InChIKey is ZSKPJHGZSCYWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C6H11NO3S/c1-7(9)8-5-3-2-4-6-8;1-6(8)7-2-4-11(9,10)5-3-7/h2-6H2,1H3;2-5H2,1H3.
What are the key properties of 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone?
1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone has a molecular weight of 304.41 g/mol, XLogP of 0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone;1-piperidin-1-ylethanone is sourced from PubChem (CID 91336310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).