C14H21NO2 — CID 91336330
2-hydroxy-N-(2,3,4,5,6-pentamethylphenyl)propanamide (PubChem CID 91336330) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-hydroxy-N-(2,3,4,5,6-pentamethylphenyl)propanamide.
| Compound Name | 2-hydroxy-N-(2,3,4,5,6-pentamethylphenyl)propanamide |
|---|---|
| PubChem CID | 91336330 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-hydroxy-N-(2,3,4,5,6-pentamethylphenyl)propanamide |
| SMILES | Cc1c(C)c(C)c(NC(=O)C(C)O)c(C)c1C |
| InChI | InChI=1S/C14H21NO2/c1-7-8(2)10(4)13(11(5)9(7)3)15-14(17)12(6)16/h12,16H,1-6H3,(H,15,17) |
| InChIKey | GTZGOFIFOSMRCD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |