C24H30ClN3O — CID 91336365
2-[(4-chlorophenyl)methyl]-7-methyl-5-[3-(4-methylpiperazin-1-yl)propyl]isoindol-1-ol (PubChem CID 91336365) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-7-methyl-5-[3-(4-methylpiperazin-1-yl)propyl]isoindol-1-ol.
| Compound Name | 2-[(4-chlorophenyl)methyl]-7-methyl-5-[3-(4-methylpiperazin-1-yl)propyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91336365 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-7-methyl-5-[3-(4-methylpiperazin-1-yl)propyl]isoindol-1-ol |
| SMILES | Cc1cc(CCCN2CCN(C)CC2)cc2cn(Cc3ccc(Cl)cc3)c(O)c12 |
| InChI | InChI=1S/C24H30ClN3O/c1-18-14-20(4-3-9-27-12-10-26(2)11-13-27)15-21-17-28(24(29)23(18)21)16-19-5-7-22(25)8-6-19/h5-8,14-15,17,29H,3-4,9-13,16H2,1-2H3 |
| InChIKey | FYGBTMQYBVOANN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |