C22H35F15O3 — CID 91336686
8-butan-2-yloxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;bis(2-methoxybutane) (PubChem CID 91336686) has the molecular formula C22H35F15O3 and a molecular weight of 632.49 g/mol. Its IUPAC name is 8-butan-2-yloxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;bis(2-methoxybutane).
| Compound Name | 8-butan-2-yloxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;bis(2-methoxybutane) |
|---|---|
| PubChem CID | 91336686 |
| Molecular Formula | C22H35F15O3 |
| Molecular Weight | 632.49 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | 8-butan-2-yloxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;bis(2-methoxybutane) |
| SMILES | CCC(C)OC.CCC(C)OC.CCC(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F15O.2C5H12O/c1-3-5(2)28-4-6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27;2*1-4-5(2)6-3/h5H,3-4H2,1-2H3;2*5H,4H2,1-3H3 |
| InChIKey | ODTYZLLDGORCBN-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.49 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|