C24H32N4O5S — CID 91336761
tert-butyl N-[5-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazin-1-yl]-5-oxopentyl]carbamate (PubChem CID 91336761) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazin-1-yl]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazin-1-yl]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 91336761 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | tert-butyl N-[5-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazin-1-yl]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)N1CCN(c2ccccc2C=C2SC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C24H32N4O5S/c1-24(2,3)33-22(31)25-11-7-6-10-20(29)28-14-12-27(13-15-28)18-9-5-4-8-17(18)16-19-21(30)26-23(32)34-19/h4-5,8-9,16H,6-7,10-15H2,1-3H3,(H,25,31)(H,26,30,32) |
| InChIKey | DWCUJNCMXDFOQS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|