C14H21N3O4S2 — CID 91336985
ethyl 2-[2-[acetyl(morpholin-2-ylmethyl)amino]sulfanyl-1,3-thiazol-4-yl]acetate (PubChem CID 91336985) has the molecular formula C14H21N3O4S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl 2-[2-[acetyl(morpholin-2-ylmethyl)amino]sulfanyl-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[acetyl(morpholin-2-ylmethyl)amino]sulfanyl-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 91336985 |
| Molecular Formula | C14H21N3O4S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | ethyl 2-[2-[acetyl(morpholin-2-ylmethyl)amino]sulfanyl-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(SN(CC2CNCCO2)C(C)=O)n1 |
| InChI | InChI=1S/C14H21N3O4S2/c1-3-20-13(19)6-11-9-22-14(16-11)23-17(10(2)18)8-12-7-15-4-5-21-12/h9,12,15H,3-8H2,1-2H3 |
| InChIKey | QBCGEGMHNKXLGA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|