About 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine
6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine (PubChem CID 91337480) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine.
Molecular Properties
| Compound Name | 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine |
| PubChem CID | 91337480 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine |
| SMILES | NCC1=CCC(N)CO1 |
| InChI | InChI=1S/C6H12N2O/c7-3-6-2-1-5(8)4-9-6/h2,5H,1,3-4,7-8H2 |
| InChIKey | SKTKEWZCWBGXRX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine?
The IUPAC name of 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine (CID 91337480) is 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine.
What is the SMILES notation for 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine?
The canonical SMILES for 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine is NCC1=CCC(N)CO1.
What is the InChIKey of 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine?
The InChIKey is SKTKEWZCWBGXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c7-3-6-2-1-5(8)4-9-6/h2,5H,1,3-4,7-8H2.
What are the key properties of 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine?
6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine has a molecular weight of 128.17 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-3,4-dihydro-2H-pyran-3-amine is sourced from PubChem (CID 91337480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).