About N'-methoxybutanimidamide
N'-methoxybutanimidamide (PubChem CID 91337648) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is N'-methoxybutanimidamide.
Molecular Properties
| Compound Name | N'-methoxybutanimidamide |
| PubChem CID | 91337648 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | N'-methoxybutanimidamide |
| SMILES | CCC/C(N)=N\OC |
| InChI | InChI=1S/C5H12N2O/c1-3-4-5(6)7-8-2/h3-4H2,1-2H3,(H2,6,7) |
| InChIKey | OSLPERSPPKAQKO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methoxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methoxybutanimidamide?
The IUPAC name of N'-methoxybutanimidamide (CID 91337648) is N'-methoxybutanimidamide.
What is the SMILES notation for N'-methoxybutanimidamide?
The canonical SMILES for N'-methoxybutanimidamide is CCC/C(N)=N\OC.
What is the InChIKey of N'-methoxybutanimidamide?
The InChIKey is OSLPERSPPKAQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-3-4-5(6)7-8-2/h3-4H2,1-2H3,(H2,6,7).
What are the key properties of N'-methoxybutanimidamide?
N'-methoxybutanimidamide has a molecular weight of 116.16 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methoxybutanimidamide is sourced from PubChem (CID 91337648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).