About N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine
N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine (PubChem CID 91337811) has the molecular formula C14H25N3
and a molecular weight of 235.38 g/mol. Its IUPAC name is N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine |
| PubChem CID | 91337811 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(CCNC(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C14H25N3/c1-12(2)17(11-10-16-14(3,4)5)13-8-6-7-9-15-13/h6-9,12,16H,10-11H2,1-5H3 |
| InChIKey | LSOHUZMETNGQRC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine?
The IUPAC name of N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine (CID 91337811) is N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine.
What is the SMILES notation for N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine?
The canonical SMILES for N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine is CC(C)N(CCNC(C)(C)C)c1ccccn1.
What is the InChIKey of N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine?
The InChIKey is LSOHUZMETNGQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3/c1-12(2)17(11-10-16-14(3,4)5)13-8-6-7-9-15-13/h6-9,12,16H,10-11H2,1-5H3.
What are the key properties of N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine?
N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine has a molecular weight of 235.38 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-propan-2-yl-N'-pyridin-2-ylethane-1,2-diamine is sourced from PubChem (CID 91337811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).