About 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid
3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid (PubChem CID 91338082) has the molecular formula C20H27NO5
and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid |
| PubChem CID | 91338082 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid |
| SMILES | COc1cc(C)c2c(c1)OC1(CCN(C(=O)O)CC1)C(C(C)(C)C)C2=O |
| InChI | InChI=1S/C20H27NO5/c1-12-10-13(25-5)11-14-15(12)16(22)17(19(2,3)4)20(26-14)6-8-21(9-7-20)18(23)24/h10-11,17H,6-9H2,1-5H3,(H,23,24) |
| InChIKey | NZZLTJTWUTYZQD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
The IUPAC name of 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid (CID 91338082) is 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid.
What is the SMILES notation for 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
The canonical SMILES for 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid is COc1cc(C)c2c(c1)OC1(CCN(C(=O)O)CC1)C(C(C)(C)C)C2=O.
What is the InChIKey of 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
The InChIKey is NZZLTJTWUTYZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO5/c1-12-10-13(25-5)11-14-15(12)16(22)17(19(2,3)4)20(26-14)6-8-21(9-7-20)18(23)24/h10-11,17H,6-9H2,1-5H3,(H,23,24).
What are the key properties of 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid has a molecular weight of 361.44 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-7-methoxy-5-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid is sourced from PubChem (CID 91338082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).