C17H21N2+ — CID 91338206
5-ethenyl-1,5,6,6-tetramethylimidazo[2,1-a]isoquinolin-1-ium (PubChem CID 91338206) has the molecular formula C17H21N2+ and a molecular weight of 253.37 g/mol. Its IUPAC name is 5-ethenyl-1,5,6,6-tetramethylimidazo[2,1-a]isoquinolin-1-ium.
| Compound Name | 5-ethenyl-1,5,6,6-tetramethylimidazo[2,1-a]isoquinolin-1-ium |
|---|---|
| PubChem CID | 91338206 |
| Molecular Formula | C17H21N2+ |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 5-ethenyl-1,5,6,6-tetramethylimidazo[2,1-a]isoquinolin-1-ium |
| SMILES | C=CC1(C)n2cc[n+](C)c2-c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H21N2/c1-6-17(4)16(2,3)14-10-8-7-9-13(14)15-18(5)11-12-19(15)17/h6-12H,1H2,2-5H3/q+1 |
| InChIKey | MOCIAAFGQBIOBD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|