C22H26ClN3O4S — CID 91338415
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91338415) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91338415 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nncn3C)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C22H26ClN3O4S/c1-26-13-24-25-21(26)31-19-17(27)12-22(30-20(19)28,15-5-3-4-6-15)10-9-14-7-8-18(29-2)16(23)11-14/h7-8,11,13,15,19H,3-6,9-10,12H2,1-2H3 |
| InChIKey | WBLOUPCWOKXTFQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|