C9H9F7O2 — CID 91338437
5,5,6,6-tetrafluoro-2-methyl-3-(2,2,2-trifluoroethyl)hex-2-enoic acid (PubChem CID 91338437) has the molecular formula C9H9F7O2 and a molecular weight of 282.16 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-2-methyl-3-(2,2,2-trifluoroethyl)hex-2-enoic acid.
| Compound Name | 5,5,6,6-tetrafluoro-2-methyl-3-(2,2,2-trifluoroethyl)hex-2-enoic acid |
|---|---|
| PubChem CID | 91338437 |
| Molecular Formula | C9H9F7O2 |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5,5,6,6-tetrafluoro-2-methyl-3-(2,2,2-trifluoroethyl)hex-2-enoic acid |
| SMILES | CC(C(=O)O)=C(CC(F)(F)F)CC(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F7O2/c1-4(6(17)18)5(3-9(14,15)16)2-8(12,13)7(10)11/h7H,2-3H2,1H3,(H,17,18) |
| InChIKey | LJKXUUCGLXGUTP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|