About pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate
pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate (PubChem CID 91338734) has the molecular formula C23H20ClFN4O4
and a molecular weight of 470.89 g/mol. Its IUPAC name is pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate.
Molecular Properties
| Compound Name | pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate |
| PubChem CID | 91338734 |
| Molecular Formula | C23H20ClFN4O4 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate |
| SMILES | CC(NC(=O)C1(NC(=O)Oc2cncnc2)CC1)c1ccc(Oc2ccccc2Cl)cc1F |
| InChI | InChI=1S/C23H20ClFN4O4/c1-14(17-7-6-15(10-19(17)25)32-20-5-3-2-4-18(20)24)28-21(30)23(8-9-23)29-22(31)33-16-11-26-13-27-12-16/h2-7,10-14H,8-9H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | WJKVBWRVKGUZIH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate?
The IUPAC name of pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate (CID 91338734) is pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate.
What is the SMILES notation for pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate?
The canonical SMILES for pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate is CC(NC(=O)C1(NC(=O)Oc2cncnc2)CC1)c1ccc(Oc2ccccc2Cl)cc1F.
What is the InChIKey of pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate?
The InChIKey is WJKVBWRVKGUZIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClFN4O4/c1-14(17-7-6-15(10-19(17)25)32-20-5-3-2-4-18(20)24)28-21(30)23(8-9-23)29-22(31)33-16-11-26-13-27-12-16/h2-7,10-14H,8-9H2,1H3,(H,28,30)(H,29,31).
What are the key properties of pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate?
pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate has a molecular weight of 470.89 g/mol, XLogP of 4.56, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-5-yl N-[1-[1-[4-(2-chlorophenoxy)-2-fluorophenyl]ethylcarbamoyl]cyclopropyl]carbamate is sourced from PubChem (CID 91338734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).