About 5-ethyltetradeca-4,6-diene
5-ethyltetradeca-4,6-diene (PubChem CID 91339198) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 5-ethyltetradeca-4,6-diene.
Molecular Properties
| Compound Name | 5-ethyltetradeca-4,6-diene |
| PubChem CID | 91339198 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 5-ethyltetradeca-4,6-diene |
| SMILES | CCCC=C(C=CCCCCCCC)CC |
| InChI | InChI=1S/C16H30/c1-4-7-9-10-11-12-13-15-16(6-3)14-8-5-2/h13-15H,4-12H2,1-3H3 |
| InChIKey | BJEJWBUIEYSBPI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyltetradeca-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyltetradeca-4,6-diene?
The IUPAC name of 5-ethyltetradeca-4,6-diene (CID 91339198) is 5-ethyltetradeca-4,6-diene.
What is the SMILES notation for 5-ethyltetradeca-4,6-diene?
The canonical SMILES for 5-ethyltetradeca-4,6-diene is CCCC=C(C=CCCCCCCC)CC.
What is the InChIKey of 5-ethyltetradeca-4,6-diene?
The InChIKey is BJEJWBUIEYSBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-4-7-9-10-11-12-13-15-16(6-3)14-8-5-2/h13-15H,4-12H2,1-3H3.
What are the key properties of 5-ethyltetradeca-4,6-diene?
5-ethyltetradeca-4,6-diene has a molecular weight of 222.42 g/mol, XLogP of 6.04, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyltetradeca-4,6-diene is sourced from PubChem (CID 91339198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).