C32H54O3Si — CID 91339326
(4R)-4-[(10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 91339326) has the molecular formula C32H54O3Si and a molecular weight of 514.87 g/mol. Its IUPAC name is (4R)-4-[(10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 91339326 |
| Molecular Formula | C32H54O3Si |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.38 |
| IUPAC Name | (4R)-4-[(10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3 |
| InChI | InChI=1S/C32H54O3Si/c1-21(11-16-28(33)34)23-13-14-24-22-12-15-26-30(5,6)27(35-36(9,10)29(2,3)4)18-20-32(26,8)25(22)17-19-31(23,24)7/h14,21,23,26-27H,11-13,15-20H2,1-10H3,(H,33,34)/t21-,23-,26?,27?,31-,32-/m1/s1 |
| InChIKey | MTHHWVZRNZCVJS-CWQONCFDSA-N |
| XLogP | 9.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|