C13H23NO2 — CID 91339749
N-(3,7-dimethylocta-2,6-dienyl)-2-hydroxypropanamide (PubChem CID 91339749) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)-2-hydroxypropanamide.
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 91339749 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)-2-hydroxypropanamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)C(C)O |
| InChI | InChI=1S/C13H23NO2/c1-10(2)6-5-7-11(3)8-9-14-13(16)12(4)15/h6,8,12,15H,5,7,9H2,1-4H3,(H,14,16) |
| InChIKey | XJPPJYZNXFEKRC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|