About N-benzyl-4-fluoroaniline
N-benzyl-4-fluoroaniline (PubChem CID 913402) has the molecular formula C13H12FN
and a molecular weight of 201.24 g/mol. Its IUPAC name is N-benzyl-4-fluoroaniline.
Molecular Properties
| Compound Name | N-benzyl-4-fluoroaniline |
| PubChem CID | 913402 |
| Molecular Formula | C13H12FN |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-benzyl-4-fluoroaniline |
| SMILES | Fc1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12FN/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,15H,10H2 |
| InChIKey | VGUGAUNYDBPMQY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-fluoroaniline?
The IUPAC name of N-benzyl-4-fluoroaniline (CID 913402) is N-benzyl-4-fluoroaniline.
What is the SMILES notation for N-benzyl-4-fluoroaniline?
The canonical SMILES for N-benzyl-4-fluoroaniline is Fc1ccc(NCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-fluoroaniline?
The InChIKey is VGUGAUNYDBPMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,15H,10H2.
What are the key properties of N-benzyl-4-fluoroaniline?
N-benzyl-4-fluoroaniline has a molecular weight of 201.24 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-fluoroaniline is sourced from PubChem (CID 913402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).