C16H24FN3O2 — CID 9134101
N-[2-(ethylamino)-2-oxoethyl]-2-[[(1S)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetamide (PubChem CID 9134101) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-2-[[(1S)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-2-[[(1S)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetamide |
|---|---|
| PubChem CID | 9134101 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-2-[[(1S)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetamide |
| SMILES | CCNC(=O)CNC(=O)CN[C@H](c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C16H24FN3O2/c1-4-18-14(21)9-19-15(22)10-20-16(11(2)3)12-5-7-13(17)8-6-12/h5-8,11,16,20H,4,9-10H2,1-3H3,(H,18,21)(H,19,22)/t16-/m0/s1 |
| InChIKey | UFAOJJHRMBOUTI-INIZCTEOSA-N |
| XLogP | 1.36 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |