About 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid
2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid (PubChem CID 91341241) has the molecular formula C8H14N2O6
and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid |
| PubChem CID | 91341241 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid |
| SMILES | NC1C(O)COC(C(=O)NCC(=O)O)C1O |
| InChI | InChI=1S/C8H14N2O6/c9-5-3(11)2-16-7(6(5)14)8(15)10-1-4(12)13/h3,5-7,11,14H,1-2,9H2,(H,10,15)(H,12,13) |
| InChIKey | QBLHGMSGJMQCGU-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid?
The IUPAC name of 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid (CID 91341241) is 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid is NC1C(O)COC(C(=O)NCC(=O)O)C1O.
What is the InChIKey of 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid?
The InChIKey is QBLHGMSGJMQCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O6/c9-5-3(11)2-16-7(6(5)14)8(15)10-1-4(12)13/h3,5-7,11,14H,1-2,9H2,(H,10,15)(H,12,13).
What are the key properties of 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid?
2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid has a molecular weight of 234.21 g/mol, XLogP of -3.36, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-3,5-dihydroxyoxane-2-carbonyl)amino]acetic acid is sourced from PubChem (CID 91341241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).