C16H5F7 — CID 91341325
1-(2,3-difluorophenyl)-2,3,4,5,6-pentafluoronaphthalene (PubChem CID 91341325) has the molecular formula C16H5F7 and a molecular weight of 330.20 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-2,3,4,5,6-pentafluoronaphthalene.
| Compound Name | 1-(2,3-difluorophenyl)-2,3,4,5,6-pentafluoronaphthalene |
|---|---|
| PubChem CID | 91341325 |
| Molecular Formula | C16H5F7 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-(2,3-difluorophenyl)-2,3,4,5,6-pentafluoronaphthalene |
| SMILES | Fc1cccc(-c2c(F)c(F)c(F)c3c(F)c(F)ccc23)c1F |
| InChI | InChI=1S/C16H5F7/c17-8-3-1-2-7(12(8)19)10-6-4-5-9(18)13(20)11(6)15(22)16(23)14(10)21/h1-5H |
| InChIKey | RHAVVUYKRRIXBO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|