C13H19N3O3 — CID 91341823
methyl (2S)-3-(1H-imidazol-5-yl)-2-[methyl(3-methylbut-2-enoyl)amino]propanoate (PubChem CID 91341823) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (2S)-3-(1H-imidazol-5-yl)-2-[methyl(3-methylbut-2-enoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[methyl(3-methylbut-2-enoyl)amino]propanoate |
|---|---|
| PubChem CID | 91341823 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[methyl(3-methylbut-2-enoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cnc[nH]1)N(C)C(=O)C=C(C)C |
| InChI | InChI=1S/C13H19N3O3/c1-9(2)5-12(17)16(3)11(13(18)19-4)6-10-7-14-8-15-10/h5,7-8,11H,6H2,1-4H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | IUVAQIFMGLCZTE-NSHDSACASA-N |
| XLogP | 0.92 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|