C19H32N2O5SSi — CID 91341923
O-[(1S,2R,4R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4,6-dimethylcyclohexyl] imidazole-1-carbothioate;carbon dioxide (PubChem CID 91341923) has the molecular formula C19H32N2O5SSi and a molecular weight of 428.63 g/mol. Its IUPAC name is O-[(1S,2R,4R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4,6-dimethylcyclohexyl] imidazole-1-carbothioate;carbon dioxide.
| Compound Name | O-[(1S,2R,4R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4,6-dimethylcyclohexyl] imidazole-1-carbothioate;carbon dioxide |
|---|---|
| PubChem CID | 91341923 |
| Molecular Formula | C19H32N2O5SSi |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | O-[(1S,2R,4R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4,6-dimethylcyclohexyl] imidazole-1-carbothioate;carbon dioxide |
| SMILES | C[C@@H]1C[C@@](C)(O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(=S)n1ccnc1.O=C=O |
| InChI | InChI=1S/C18H32N2O3SSi.CO2/c1-13-10-18(5,21)11-14(23-25(6,7)17(2,3)4)15(13)22-16(24)20-9-8-19-12-20;2-1-3/h8-9,12-15,21H,10-11H2,1-7H3;/t13-,14-,15+,18-;/m1./s1 |
| InChIKey | AGTJRVSBRXWGGF-GLCLSGQWSA-N |
| XLogP | 3.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|