C12H16N4O2 — CID 91341937
12-acetyl-3,7-dimethyl-6,7,9,11-tetrazatricyclo[7.3.0.03,5]dodeca-1(12),10-dien-8-one (PubChem CID 91341937) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 12-acetyl-3,7-dimethyl-6,7,9,11-tetrazatricyclo[7.3.0.03,5]dodeca-1(12),10-dien-8-one.
| Compound Name | 12-acetyl-3,7-dimethyl-6,7,9,11-tetrazatricyclo[7.3.0.03,5]dodeca-1(12),10-dien-8-one |
|---|---|
| PubChem CID | 91341937 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 12-acetyl-3,7-dimethyl-6,7,9,11-tetrazatricyclo[7.3.0.03,5]dodeca-1(12),10-dien-8-one |
| SMILES | CC(=O)c1ncn2c1CC1(C)CC1NN(C)C2=O |
| InChI | InChI=1S/C12H16N4O2/c1-7(17)10-8-4-12(2)5-9(12)14-15(3)11(18)16(8)6-13-10/h6,9,14H,4-5H2,1-3H3 |
| InChIKey | GNCCEBCRQAFQBF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |