C40H75NO3 — CID 91342217
19-(2-hydroxyethylamino)-19-methylheptatriaconta-9,28-diene-18,20-dione (PubChem CID 91342217) has the molecular formula C40H75NO3 and a molecular weight of 618.04 g/mol. Its IUPAC name is 19-(2-hydroxyethylamino)-19-methylheptatriaconta-9,28-diene-18,20-dione.
| Compound Name | 19-(2-hydroxyethylamino)-19-methylheptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 91342217 |
| Molecular Formula | C40H75NO3 |
| Molecular Weight | 618.04 g/mol |
| Exact Mass | 617.57 |
| IUPAC Name | 19-(2-hydroxyethylamino)-19-methylheptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(C)(NCCO)C(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C40H75NO3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38(43)40(3,41-36-37-42)39(44)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,41-42H,4-17,22-37H2,1-3H3 |
| InChIKey | JEYOTOMEOJKWQC-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.04 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|