About 2-amino-1,5-diethylpyrimidin-4-one
2-amino-1,5-diethylpyrimidin-4-one (PubChem CID 91342294) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-amino-1,5-diethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-1,5-diethylpyrimidin-4-one |
| PubChem CID | 91342294 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-amino-1,5-diethylpyrimidin-4-one |
| SMILES | CCc1cn(CC)c(N)nc1=O |
| InChI | InChI=1S/C8H13N3O/c1-3-6-5-11(4-2)8(9)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12) |
| InChIKey | FUXBAVBHJNSGJN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,5-diethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,5-diethylpyrimidin-4-one?
The IUPAC name of 2-amino-1,5-diethylpyrimidin-4-one (CID 91342294) is 2-amino-1,5-diethylpyrimidin-4-one.
What is the SMILES notation for 2-amino-1,5-diethylpyrimidin-4-one?
The canonical SMILES for 2-amino-1,5-diethylpyrimidin-4-one is CCc1cn(CC)c(N)nc1=O.
What is the InChIKey of 2-amino-1,5-diethylpyrimidin-4-one?
The InChIKey is FUXBAVBHJNSGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-3-6-5-11(4-2)8(9)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12).
What are the key properties of 2-amino-1,5-diethylpyrimidin-4-one?
2-amino-1,5-diethylpyrimidin-4-one has a molecular weight of 167.21 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,5-diethylpyrimidin-4-one is sourced from PubChem (CID 91342294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).