C22H27N3O4 — CID 9134267
1-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 9134267) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 9134267 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN2CCC(C(=O)Nc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-28-18-8-9-20(29-2)19(14-18)24-21(26)15-25-12-10-16(11-13-25)22(27)23-17-6-4-3-5-7-17/h3-9,14,16H,10-13,15H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | BKSXPXSONYZKHX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |