C27H37N3O2 — CID 91342782
(1S,2R,3R,4R)-2-[(4-methylphenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 91342782) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-[(4-methylphenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-[(4-methylphenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 91342782 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | (1S,2R,3R,4R)-2-[(4-methylphenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | Cc1ccc(C[C@@]2(C(N)=O)[C@H]3C=C[C@H](C34CC4)[C@@]2(CCCCN2CCCC2)C(N)=O)cc1 |
| InChI | InChI=1S/C27H37N3O2/c1-19-6-8-20(9-7-19)18-27(24(29)32)22-11-10-21(25(22)13-14-25)26(27,23(28)31)12-2-3-15-30-16-4-5-17-30/h6-11,21-22H,2-5,12-18H2,1H3,(H2,28,31)(H2,29,32)/t21-,22+,26+,27+/m1/s1 |
| InChIKey | PHSMNWUQZTYOCY-SEEQBUNISA-N |
| XLogP | 3.34 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|