About (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane
(2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane (PubChem CID 91342881) has the molecular formula C23H26Cl2N2O2
and a molecular weight of 433.38 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane.
Molecular Properties
| Compound Name | (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane |
| PubChem CID | 91342881 |
| Molecular Formula | C23H26Cl2N2O2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane |
| SMILES | CCOCC(C)(C)C.O=C(c1ccc(-c2ncc[nH]2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H10Cl2N2O.C7H16O/c17-12-5-6-14(18)13(9-12)15(21)10-1-3-11(4-2-10)16-19-7-8-20-16;1-5-8-6-7(2,3)4/h1-9H,(H,19,20);5-6H2,1-4H3 |
| InChIKey | RITWIRPYKOVJCC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane?
The IUPAC name of (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane (CID 91342881) is (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane.
What is the SMILES notation for (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane?
The canonical SMILES for (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane is CCOCC(C)(C)C.O=C(c1ccc(-c2ncc[nH]2)cc1)c1cc(Cl)ccc1Cl.
What is the InChIKey of (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane?
The InChIKey is RITWIRPYKOVJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2O.C7H16O/c17-12-5-6-14(18)13(9-12)15(21)10-1-3-11(4-2-10)16-19-7-8-20-16;1-5-8-6-7(2,3)4/h1-9H,(H,19,20);5-6H2,1-4H3.
What are the key properties of (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane?
(2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane has a molecular weight of 433.38 g/mol, XLogP of 6.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dichlorophenyl)-[4-(1H-imidazol-2-yl)phenyl]methanone;1-ethoxy-2,2-dimethylpropane is sourced from PubChem (CID 91342881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).