C24H16F3N5O2 — CID 91343003
methyl 1-[[2-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]indazole-5-carboxylate (PubChem CID 91343003) has the molecular formula C24H16F3N5O2 and a molecular weight of 463.42 g/mol. Its IUPAC name is methyl 1-[[2-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]indazole-5-carboxylate.
| Compound Name | methyl 1-[[2-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]indazole-5-carboxylate |
|---|---|
| PubChem CID | 91343003 |
| Molecular Formula | C24H16F3N5O2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 1-[[2-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]indazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(cnn2Nc2nc(-c3ccccc3C(F)(F)F)nc3ccccc23)c1 |
| InChI | InChI=1S/C24H16F3N5O2/c1-34-23(33)14-10-11-20-15(12-14)13-28-32(20)31-22-17-7-3-5-9-19(17)29-21(30-22)16-6-2-4-8-18(16)24(25,26)27/h2-13H,1H3,(H,29,30,31) |
| InChIKey | XSQOKJSPXOAGCB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |