C20H26O — CID 91344405
ethane;(13R,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 91344405) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is ethane;(13R,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | ethane;(13R,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 91344405 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | ethane;(13R,14R,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC.C[C@@]12CCc3c(ccc4ccccc34)[C@H]1CC[C@@H]2O |
| InChI | InChI=1S/C18H20O.C2H6/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19;1-2/h2-7,16-17,19H,8-11H2,1H3;1-2H3/t16-,17+,18-;/m1./s1 |
| InChIKey | VFAGAKVCZFTXEU-VYXWTPOFSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |