C24H25BrCl2N4O4 — CID 91344653
ethyl (2S)-2-[(2-bromo-1-oxaspiro[3.5]nonan-3-ylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate (PubChem CID 91344653) has the molecular formula C24H25BrCl2N4O4 and a molecular weight of 584.30 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-bromo-1-oxaspiro[3.5]nonan-3-ylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate.
| Compound Name | ethyl (2S)-2-[(2-bromo-1-oxaspiro[3.5]nonan-3-ylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 91344653 |
| Molecular Formula | C24H25BrCl2N4O4 |
| Molecular Weight | 584.30 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | ethyl (2S)-2-[(2-bromo-1-oxaspiro[3.5]nonan-3-ylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cn1)/N=C1\C(Br)OC12CCCCC2 |
| InChI | InChI=1S/C24H25BrCl2N4O4/c1-2-34-23(33)18(31-20-21(25)35-24(20)8-4-3-5-9-24)10-14-6-7-15(11-29-14)30-22(32)19-16(26)12-28-13-17(19)27/h6-7,11-13,18,21H,2-5,8-10H2,1H3,(H,30,32)/b31-20+/t18-,21?/m0/s1 |
| InChIKey | BMKNOUCGILDUJC-RHKRBOECSA-N |
| XLogP | 5.41 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|