About 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane
1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane (PubChem CID 91344923) has the molecular formula C5H10F3NO5S2
and a molecular weight of 285.27 g/mol. Its IUPAC name is 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane.
Molecular Properties
| Compound Name | 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane |
| PubChem CID | 91344923 |
| Molecular Formula | C5H10F3NO5S2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane |
| SMILES | CC.CS(=O)(=O)NC(=O)C(F)(F)S(=O)(=O)F |
| InChI | InChI=1S/C3H4F3NO5S2.C2H6/c1-13(9,10)7-2(8)3(4,5)14(6,11)12;1-2/h1H3,(H,7,8);1-2H3 |
| InChIKey | UPDUCGNXTWHAER-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane?
The IUPAC name of 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane (CID 91344923) is 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane.
What is the SMILES notation for 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane?
The canonical SMILES for 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane is CC.CS(=O)(=O)NC(=O)C(F)(F)S(=O)(=O)F.
What is the InChIKey of 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane?
The InChIKey is UPDUCGNXTWHAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F3NO5S2.C2H6/c1-13(9,10)7-2(8)3(4,5)14(6,11)12;1-2/h1H3,(H,7,8);1-2H3.
What are the key properties of 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane?
1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane has a molecular weight of 285.27 g/mol, XLogP of -0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-(methanesulfonamido)-2-oxoethanesulfonyl fluoride;ethane is sourced from PubChem (CID 91344923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).