About 1-benzothiophene-3,7-diol
1-benzothiophene-3,7-diol (PubChem CID 91345161) has the molecular formula C8H6O2S
and a molecular weight of 166.20 g/mol. Its IUPAC name is 1-benzothiophene-3,7-diol.
Molecular Properties
| Compound Name | 1-benzothiophene-3,7-diol |
| PubChem CID | 91345161 |
| Molecular Formula | C8H6O2S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 1-benzothiophene-3,7-diol |
| SMILES | Oc1csc2c(O)cccc12 |
| InChI | InChI=1S/C8H6O2S/c9-6-3-1-2-5-7(10)4-11-8(5)6/h1-4,9-10H |
| InChIKey | FMJIHSIHIAKBGD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene-3,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene-3,7-diol?
The IUPAC name of 1-benzothiophene-3,7-diol (CID 91345161) is 1-benzothiophene-3,7-diol.
What is the SMILES notation for 1-benzothiophene-3,7-diol?
The canonical SMILES for 1-benzothiophene-3,7-diol is Oc1csc2c(O)cccc12.
What is the InChIKey of 1-benzothiophene-3,7-diol?
The InChIKey is FMJIHSIHIAKBGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2S/c9-6-3-1-2-5-7(10)4-11-8(5)6/h1-4,9-10H.
What are the key properties of 1-benzothiophene-3,7-diol?
1-benzothiophene-3,7-diol has a molecular weight of 166.20 g/mol, XLogP of 2.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene-3,7-diol is sourced from PubChem (CID 91345161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).