C17H14FN3O — CID 91345190
10-[(4-fluorophenyl)methylideneamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-11-ol (PubChem CID 91345190) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is 10-[(4-fluorophenyl)methylideneamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-11-ol.
| Compound Name | 10-[(4-fluorophenyl)methylideneamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-11-ol |
|---|---|
| PubChem CID | 91345190 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 10-[(4-fluorophenyl)methylideneamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-11-ol |
| SMILES | Oc1c(/N=C/c2ccc(F)cc2)cc2c3c(c[nH]c13)CCN2 |
| InChI | InChI=1S/C17H14FN3O/c18-12-3-1-10(2-4-12)8-20-14-7-13-15-11(5-6-19-13)9-21-16(15)17(14)22/h1-4,7-9,19,21-22H,5-6H2/b20-8+ |
| InChIKey | AACXEMAYXCJILL-DNTJNYDQSA-N |
| XLogP | 3.73 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|