C24H26N2O4 — CID 91345342
ethyl N-[[(4aS)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-3,4,9,10-tetrahydrophenanthren-2-ylidene]amino]carbamate (PubChem CID 91345342) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl N-[[(4aS)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-3,4,9,10-tetrahydrophenanthren-2-ylidene]amino]carbamate.
| Compound Name | ethyl N-[[(4aS)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-3,4,9,10-tetrahydrophenanthren-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 91345342 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl N-[[(4aS)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-3,4,9,10-tetrahydrophenanthren-2-ylidene]amino]carbamate |
| SMILES | CCOC(=O)NN=C1C=C2CCc3cc(O)ccc3[C@]2(Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C24H26N2O4/c1-2-30-23(29)26-25-19-11-12-24(15-16-3-7-20(27)8-4-16)18(14-19)6-5-17-13-21(28)9-10-22(17)24/h3-4,7-10,13-14,27-28H,2,5-6,11-12,15H2,1H3,(H,26,29)/t24-/m0/s1 |
| InChIKey | JXNLVYMWFPBWNG-DEOSSOPVSA-N |
| XLogP | 4.35 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|