C30H44O13 — CID 91346381
[4-acetyloxy-5-(2-methylprop-2-enyl)-2-propyl-5-[3,4,5-triacetyloxy-6-(2-methylprop-2-enyl)oxan-2-yl]oxyoxolan-3-yl] acetate (PubChem CID 91346381) has the molecular formula C30H44O13 and a molecular weight of 612.67 g/mol. Its IUPAC name is [4-acetyloxy-5-(2-methylprop-2-enyl)-2-propyl-5-[3,4,5-triacetyloxy-6-(2-methylprop-2-enyl)oxan-2-yl]oxyoxolan-3-yl] acetate.
| Compound Name | [4-acetyloxy-5-(2-methylprop-2-enyl)-2-propyl-5-[3,4,5-triacetyloxy-6-(2-methylprop-2-enyl)oxan-2-yl]oxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 91346381 |
| Molecular Formula | C30H44O13 |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | [4-acetyloxy-5-(2-methylprop-2-enyl)-2-propyl-5-[3,4,5-triacetyloxy-6-(2-methylprop-2-enyl)oxan-2-yl]oxyoxolan-3-yl] acetate |
| SMILES | C=C(C)CC1OC(OC2(CC(=C)C)OC(CCC)C(OC(C)=O)C2OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C30H44O13/c1-11-12-22-25(37-18(7)32)28(40-21(10)35)30(42-22,14-16(4)5)43-29-27(39-20(9)34)26(38-19(8)33)24(36-17(6)31)23(41-29)13-15(2)3/h22-29H,2,4,11-14H2,1,3,5-10H3 |
| InChIKey | YGFYSSLEFHVSBQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|