About ethane;3-nitro-2H-chromene
ethane;3-nitro-2H-chromene (PubChem CID 91346584) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is ethane;3-nitro-2H-chromene.
Molecular Properties
| Compound Name | ethane;3-nitro-2H-chromene |
| PubChem CID | 91346584 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | ethane;3-nitro-2H-chromene |
| SMILES | CC.O=[N+]([O-])C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C9H7NO3.C2H6/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8;1-2/h1-5H,6H2;1-2H3 |
| InChIKey | ORHYZYWGMDHRIP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-nitro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-nitro-2H-chromene?
The IUPAC name of ethane;3-nitro-2H-chromene (CID 91346584) is ethane;3-nitro-2H-chromene.
What is the SMILES notation for ethane;3-nitro-2H-chromene?
The canonical SMILES for ethane;3-nitro-2H-chromene is CC.O=[N+]([O-])C1=Cc2ccccc2OC1.
What is the InChIKey of ethane;3-nitro-2H-chromene?
The InChIKey is ORHYZYWGMDHRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3.C2H6/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8;1-2/h1-5H,6H2;1-2H3.
What are the key properties of ethane;3-nitro-2H-chromene?
ethane;3-nitro-2H-chromene has a molecular weight of 207.23 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-nitro-2H-chromene is sourced from PubChem (CID 91346584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).