C15H18 — CID 91346586
8-methyl-7,10-dimethylidene-5,6,8,9-tetrahydrobenzo[8]annulene (PubChem CID 91346586) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 8-methyl-7,10-dimethylidene-5,6,8,9-tetrahydrobenzo[8]annulene.
| Compound Name | 8-methyl-7,10-dimethylidene-5,6,8,9-tetrahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 91346586 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 8-methyl-7,10-dimethylidene-5,6,8,9-tetrahydrobenzo[8]annulene |
| SMILES | C=C1CC(C)C(=C)CCc2ccccc21 |
| InChI | InChI=1S/C15H18/c1-11-8-9-14-6-4-5-7-15(14)13(3)10-12(11)2/h4-7,12H,1,3,8-10H2,2H3 |
| InChIKey | UVYOHYRGMJMHBI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|