About N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol
N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol (PubChem CID 91346771) has the molecular formula C12H31N3O2
and a molecular weight of 249.40 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol |
| PubChem CID | 91346771 |
| Molecular Formula | C12H31N3O2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.24 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol |
| SMILES | CCCCOCC(O)CC.NCCNCCN |
| InChI | InChI=1S/C8H18O2.C4H13N3/c1-3-5-6-10-7-8(9)4-2;5-1-3-7-4-2-6/h8-9H,3-7H2,1-2H3;7H,1-6H2 |
| InChIKey | NEKMQPUPZINRMO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol?
The IUPAC name of N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol (CID 91346771) is N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol.
What is the SMILES notation for N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol?
The canonical SMILES for N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol is CCCCOCC(O)CC.NCCNCCN.
What is the InChIKey of N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol?
The InChIKey is NEKMQPUPZINRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C4H13N3/c1-3-5-6-10-7-8(9)4-2;5-1-3-7-4-2-6/h8-9H,3-7H2,1-2H3;7H,1-6H2.
What are the key properties of N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol?
N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol has a molecular weight of 249.40 g/mol, XLogP of 0.07, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)ethane-1,2-diamine;1-butoxybutan-2-ol is sourced from PubChem (CID 91346771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).