C37H46N5O4+ — CID 91347087
pentyl N-[1-[6-(3,4-dimethoxyphenyl)-2-[2-(3-ethyl-4-methylquinolin-2-yl)ethenyl]pyrimidin-4-yl]-1-methylpyrrolidin-1-ium-3-yl]carbamate (PubChem CID 91347087) has the molecular formula C37H46N5O4+ and a molecular weight of 624.81 g/mol. Its IUPAC name is pentyl N-[1-[6-(3,4-dimethoxyphenyl)-2-[2-(3-ethyl-4-methylquinolin-2-yl)ethenyl]pyrimidin-4-yl]-1-methylpyrrolidin-1-ium-3-yl]carbamate.
| Compound Name | pentyl N-[1-[6-(3,4-dimethoxyphenyl)-2-[2-(3-ethyl-4-methylquinolin-2-yl)ethenyl]pyrimidin-4-yl]-1-methylpyrrolidin-1-ium-3-yl]carbamate |
|---|---|
| PubChem CID | 91347087 |
| Molecular Formula | C37H46N5O4+ |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | pentyl N-[1-[6-(3,4-dimethoxyphenyl)-2-[2-(3-ethyl-4-methylquinolin-2-yl)ethenyl]pyrimidin-4-yl]-1-methylpyrrolidin-1-ium-3-yl]carbamate |
| SMILES | CCCCCOC(=O)NC1CC[N+](C)(c2cc(-c3ccc(OC)c(OC)c3)nc(C=Cc3nc4ccccc4c(C)c3CC)n2)C1 |
| InChI | InChI=1S/C37H45N5O4/c1-7-9-12-21-46-37(43)38-27-19-20-42(4,24-27)36-23-32(26-15-17-33(44-5)34(22-26)45-6)40-35(41-36)18-16-31-28(8-2)25(3)29-13-10-11-14-30(29)39-31/h10-11,13-18,22-23,27H,7-9,12,19-21,24H2,1-6H3/p+1 |
| InChIKey | GDGVZZFUFKHHDX-UHFFFAOYSA-O |
| XLogP | 7.38 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|