C25H29ClN4O4 — CID 91347109
acetic acid;2-[3-[3-(3-chlorophenyl)propylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid (PubChem CID 91347109) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is acetic acid;2-[3-[3-(3-chlorophenyl)propylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid.
| Compound Name | acetic acid;2-[3-[3-(3-chlorophenyl)propylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 91347109 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | acetic acid;2-[3-[3-(3-chlorophenyl)propylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid |
| SMILES | CC(=O)O.O=C(O)c1c2c(nn1CCCNCCCc1cccc(Cl)c1)-c1ccncc1CC2 |
| InChI | InChI=1S/C23H25ClN4O2.C2H4O2/c24-18-6-1-4-16(14-18)5-2-10-25-11-3-13-28-22(23(29)30)20-8-7-17-15-26-12-9-19(17)21(20)27-28;1-2(3)4/h1,4,6,9,12,14-15,25H,2-3,5,7-8,10-11,13H2,(H,29,30);1H3,(H,3,4) |
| InChIKey | IRCSHSIMHRVJHR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|