C23H29N4O3+ — CID 9134734
1-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9134734) has the molecular formula C23H29N4O3+ and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9134734 |
| Molecular Formula | C23H29N4O3+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)C[NH+]2CCC(C(=O)Nc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-2-24-22(29)18-7-6-10-20(15-18)25-21(28)16-27-13-11-17(12-14-27)23(30)26-19-8-4-3-5-9-19/h3-10,15,17H,2,11-14,16H2,1H3,(H,24,29)(H,25,28)(H,26,30)/p+1 |
| InChIKey | ZUXHHRJPXBZQGP-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |