C22H23FN4O6S2 — CID 91347395
N-[7-[[2-(dimethylaminoperoxysulfanyl)-4-fluorophenyl]methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl]-N-methylmethanesulfonamide (PubChem CID 91347395) has the molecular formula C22H23FN4O6S2 and a molecular weight of 522.58 g/mol. Its IUPAC name is N-[7-[[2-(dimethylaminoperoxysulfanyl)-4-fluorophenyl]methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[7-[[2-(dimethylaminoperoxysulfanyl)-4-fluorophenyl]methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 91347395 |
| Molecular Formula | C22H23FN4O6S2 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | N-[7-[[2-(dimethylaminoperoxysulfanyl)-4-fluorophenyl]methyl]-8,9-dihydroxypyrrolo[3,4-g]quinolin-5-yl]-N-methylmethanesulfonamide |
| SMILES | CN(C)OOSc1cc(F)ccc1Cn1cc2c(N(C)S(C)(=O)=O)c3cccnc3c(O)c2c1O |
| InChI | InChI=1S/C22H23FN4O6S2/c1-25(2)32-33-34-17-10-14(23)8-7-13(17)11-27-12-16-18(22(27)29)21(28)19-15(6-5-9-24-19)20(16)26(3)35(4,30)31/h5-10,12,28-29H,11H2,1-4H3 |
| InChIKey | OCLNKOIVJVLKQL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|