About [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 9134753) has the molecular formula C22H19FN2O4
and a molecular weight of 394.40 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate.
Molecular Properties
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate |
| PubChem CID | 9134753 |
| Molecular Formula | C22H19FN2O4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1c(COC(=O)c2ccccc2N2CCCC2=O)noc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FN2O4/c1-14-18(24-29-21(14)15-8-10-16(23)11-9-15)13-28-22(27)17-5-2-3-6-19(17)25-12-4-7-20(25)26/h2-3,5-6,8-11H,4,7,12-13H2,1H3 |
| InChIKey | YDRJVQFENLWNHX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate?
The IUPAC name of [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate (CID 9134753) is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate.
What is the SMILES notation for [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate?
The canonical SMILES for [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate is Cc1c(COC(=O)c2ccccc2N2CCCC2=O)noc1-c1ccc(F)cc1.
What is the InChIKey of [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate?
The InChIKey is YDRJVQFENLWNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN2O4/c1-14-18(24-29-21(14)15-8-10-16(23)11-9-15)13-28-22(27)17-5-2-3-6-19(17)25-12-4-7-20(25)26/h2-3,5-6,8-11H,4,7,12-13H2,1H3.
What are the key properties of [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate?
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate has a molecular weight of 394.40 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2-oxopyrrolidin-1-yl)benzoate is sourced from PubChem (CID 9134753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).